338739-44-9 Usage
Uses
Used in Pharmaceutical Industry:
4,6-Dichloro-2-methylquinazoline is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, 4,6-Dichloro-2-methylquinazoline serves as an intermediate in the production of pesticides and other crop protection agents. Its incorporation into these products can enhance their effectiveness in controlling pests and diseases, thereby improving crop yields and quality.
Used in Organic Synthesis:
4,6-Dichloro-2-methylquinazoline is employed as a reagent in organic synthesis for the preparation of a wide range of organic compounds. Its versatile chemical properties make it a valuable tool in the synthesis of complex organic molecules, including those with potential applications in various industries such as pharmaceuticals, materials science, and specialty chemicals.
Safety Precautions:
Due to its potential hazards, it is crucial to handle 4,6-Dichloro-2-methylquinazoline with care. Appropriate safety measures, such as wearing protective clothing, using eye and skin protection, and ensuring proper ventilation, should be taken to minimize the risk of exposure and associated health issues.
Check Digit Verification of cas no
The CAS Registry Mumber 338739-44-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,8,7,3 and 9 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 338739-44:
(8*3)+(7*3)+(6*8)+(5*7)+(4*3)+(3*9)+(2*4)+(1*4)=179
179 % 10 = 9
So 338739-44-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H6Cl2N2/c1-5-12-8-3-2-6(10)4-7(8)9(11)13-5/h2-4H,1H3
338739-44-9Relevant academic research and scientific papers
ANTIMICROBIAL COMPOUNDS BASED UPON 4-AMINOQUINOLINE
-
Page/Page column 68-69, (2008/12/04)
There is provided compounds of formula I wherein R1, R2, R3, R4, X1, X2 and A have meanings given in the description. Also provided are medical uses of such compounds, such as the killing c
