33879-32-2 Usage
Uses
Used in Scientific Research:
3-Methoxy-L-Phenylalanine is used as a research compound for studying its properties and potential applications in various fields. 3-METHOXY-L-PHENYLALANINE's rarity and limited availability make it a valuable subject for scientific inquiry.
Used in Nutritional Supplements:
3-Methoxy-L-Phenylalanine is used as a dietary supplement for individuals who may require additional essential amino acids in their diet. As an essential amino acid, it plays a crucial role in protein synthesis and overall health.
Used in Pharmaceutical Development:
3-Methoxy-L-Phenylalanine is used as a potential therapeutic agent in the development of new pharmaceuticals. Its unique structure and properties may offer opportunities for the treatment of various health conditions, although further research is needed to fully understand its safety and efficacy in humans.
Check Digit Verification of cas no
The CAS Registry Mumber 33879-32-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,8,7 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 33879-32:
(7*3)+(6*3)+(5*8)+(4*7)+(3*9)+(2*3)+(1*2)=142
142 % 10 = 2
So 33879-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1
