338976-44-6 Usage
Uses
Used in Organic Synthesis:
6-(ISOPROPYLTHIO)IMIDAZO[2,1-B][1,3]THIAZOLE-5-CARBOXALDEHYDE is used as a building block in organic synthesis for the creation of other organic compounds. Its unique structure and functional groups allow for the introduction of specific functional groups into molecules, facilitating the development of new chemical entities.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-(ISOPROPYLTHIO)IMIDAZO[2,1-B][1,3]THIAZOLE-5-CARBOXALDEHYDE is used as a potential candidate for the development of new drugs. Its structural features and functional groups can be leveraged to design and synthesize drug molecules with specific therapeutic properties.
Used in Materials Science:
6-(ISOPROPYLTHIO)IMIDAZO[2,1-B][1,3]THIAZOLE-5-CARBOXALDEHYDE is also used in materials science for the development of new materials with specific properties. Its unique structure and functional groups can contribute to the creation of materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 338976-44-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,8,9,7 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 338976-44:
(8*3)+(7*3)+(6*8)+(5*9)+(4*7)+(3*6)+(2*4)+(1*4)=196
196 % 10 = 6
So 338976-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2OS2/c1-6(2)14-8-7(5-12)11-3-4-13-9(11)10-8/h3-6H,1-2H3
