339016-33-0 Usage
Uses
Used in Pharmaceutical Industry:
2-[1-(3-CHLOROBENZYL)-1H-INDOL-3-YL]ACETIC ACID is used as a potential therapeutic agent for various medical conditions due to its potential anti-inflammatory and analgesic properties. Its unique structure and pharmacological properties make it a promising candidate for the development of new drugs.
Used in Organic Synthesis:
2-[1-(3-CHLOROBENZYL)-1H-INDOL-3-YL]ACETIC ACID is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of new chemical entities with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Used in Medicinal Research:
2-[1-(3-CHLOROBENZYL)-1H-INDOL-3-YL]ACETIC ACID is used as a research tool in the study of biological activities and mechanisms of action. Its potential pharmacological properties make it an important compound for understanding the role of indole derivatives in various biological processes and for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 339016-33-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,0,1 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 339016-33:
(8*3)+(7*3)+(6*9)+(5*0)+(4*1)+(3*6)+(2*3)+(1*3)=130
130 % 10 = 0
So 339016-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H14ClNO2/c18-14-5-3-4-12(8-14)10-19-11-13(9-17(20)21)15-6-1-2-7-16(15)19/h1-8,11H,9-10H2,(H,20,21)
