339080-29-4Relevant academic research and scientific papers
New silylated iminophosphorano(amino)phosphines Me3SiN=PPh2N(r)PPh2 (R = Et, nPr, nBu). Crystal and molecular structure of trimethylsilyliminophosphorano(propylamino)-diphenylphosphine Me3SiN=PPh2N(nPr)PPh2. Further oxidative derivatization with S, Se, and azides
Balakrishna,Teipel,Pinkerton,Cavell
, p. 1802 - 1808 (2001)
Bis(phosphino)amines Ph2PN(R)PPh2 (R = Et, nPr, nBu) react with stoichiometric amounts of trimethylsilyl azide to give the trimethylsilyliminophosphorano(amino)phosphines Me3SiN=PPh2N(R)PPh2 (1, R = Et; 2, R = nPr; 3, R = nBu) as crystalline compounds. The structure of 2 has been determined by single-crystal X-ray analysis. (Crystal data for 2: monoclinic, P21/c, a = 10.235(1) A, b = 16.802(2) A, c = 17.075(2) A, β = 101.05(1)°, V = 2882.9(5) A3, Z = 4.) The structure of 2, which is the first example of an iminophosphoranophosphine with the PIII-N-PV=N skeleton, was solved by direct methods and refined to R = 0.044. Compound 2 readily reacts with elemental sulfur, selenium, or phosphoryl azide to give fully oxidized phosphinimines Ph2P(E)N(nPr)Ph2P= NSiMe3 (4, E = S; 5, E = Se; 6, E = NP(O)(OPh)2). Compounds 4-6 are very sensitive to moisture and readily undergo desilylation to give the parent phosphinimines Ph2P(E)N(nPr)Ph2P=NH, which can be isolated as moderately stable crystalline solids. The phosphiniminophosphine 2 and the oxidized phosphinimines (4 and 5) react with CpTiCl3 to give new nitrogen-bound Ti(IV) derivatives Ph2P(E)N(nPr)Ph2P=NTi(Cp)Cl2 (10, E = lone pair; 11, E = S; 12, E = Se). Compounds 1-3 readily react with rhodium(I), palladium(II), and platinum(II) complexes to give five-membered metallacycles via phosphorus(III) and imine nitrogen coordination.
