339155-13-4 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Pyridinedicarboxylic acid is used as an active pharmaceutical ingredient for the production of isoniazid, a first-line drug for the treatment of tuberculosis. Its efficacy in combating the Mycobacterium tuberculosis bacterium makes it a crucial component in the development of anti-tuberculosis medications.
Used in Medical Research:
2,3-Pyridinedicarboxylic acid is used as a subject of study for its potential anti-inflammatory and antioxidant properties. Researchers are exploring its ability to modulate inflammatory responses and protect cells from oxidative stress, which could lead to the development of new therapeutic agents for various inflammatory and oxidative disorders.
Used in Chelating Agent Applications:
2,3-Pyridinedicarboxylic acid is used as a chelating agent in the synthesis of metal complexes. Its ability to form stable complexes with metal ions has potential applications in various fields, including catalysis, environmental remediation, and the development of new materials with unique properties.
Used in Synthesis of Metal Complexes:
2,3-Pyridinedicarboxylic acid is used as a ligand in the synthesis of metal complexes, which can exhibit a range of interesting properties, such as magnetic, optical, and electronic behaviors. These metal complexes have potential applications in areas like molecular electronics, sensors, and advanced materials development.
Check Digit Verification of cas no
The CAS Registry Mumber 339155-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,1,5 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 339155-13:
(8*3)+(7*3)+(6*9)+(5*1)+(4*5)+(3*5)+(2*1)+(1*3)=144
144 % 10 = 4
So 339155-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-2
