339182-26-2 Usage
General Description
5-(Aminomethyl)piperidin-2-one is a chemical compound with the molecular formula C7H14N2O. It is a piperidinone derivative with an aminomethyl group attached to the piperidine ring. 5-(AMINOMETHYL)PIPERIDIN-2-ONE is often used as a building block in the synthesis of various pharmaceuticals and organic compounds due to its reactivity and versatility. It can be used as a key intermediate in the preparation of various drugs and biologically active molecules. Additionally, 5-(aminomethyl)piperidin-2-one has also shown potential as a ligand in coordination chemistry and can be used in the formation of complex organic structures. Overall, this compound has applications in both the pharmaceutical and chemical industries due to its unique structural and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 339182-26-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,1,8 and 2 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 339182-26:
(8*3)+(7*3)+(6*9)+(5*1)+(4*8)+(3*2)+(2*2)+(1*6)=152
152 % 10 = 2
So 339182-26-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O/c7-3-5-1-2-6(9)8-4-5/h5H,1-4,7H2,(H,8,9)
