339279-00-4 Usage
Uses
Used in Pharmaceutical Industry:
4-CHLORO-6-(METHOXYMETHYL)-2-(3-PYRIDYL)PYRIMIDINE is used as a building block in the synthesis of various biologically active compounds. Its unique structural features and chemical reactivity allow it to be incorporated into the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical field, 4-CHLORO-6-(METHOXYMETHYL)-2-(3-PYRIDYL)PYRIMIDINE may be utilized as a precursor or intermediate in the production of agrochemicals, such as pesticides or herbicides. Its chemical properties can be harnessed to create compounds with specific biological activities, contributing to the development of more effective and targeted agrochemical products.
Further studies and research are necessary to fully explore the potential uses and properties of 4-CHLORO-6-(METHOXYMETHYL)-2-(3-PYRIDYL)PYRIMIDINE in various fields, including its potential applications in drug discovery and development, as well as its role in the creation of novel agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 339279-00-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,9,2,7 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 339279-00:
(8*3)+(7*3)+(6*9)+(5*2)+(4*7)+(3*9)+(2*0)+(1*0)=164
164 % 10 = 4
So 339279-00-4 is a valid CAS Registry Number.
InChI:InChI=1S/C11H10ClN3O/c1-16-7-9-5-10(12)15-11(14-9)8-3-2-4-13-6-8/h2-6H,7H2,1H3
