3394-30-7 Usage
Oxazolidine derivative
A type of organic compound that contains a five-membered ring with oxygen and nitrogen atoms This defines the core structure of the compound and its general properties.
3-nitrophenyl group
A phenyl ring with a nitro group (NO2) attached to the third carbon atom This functional group imparts specific reactivity and properties to the compound.
Chiral auxiliaries
Used in asymmetric synthesis This highlights one of the main applications of oxazolidines, including 2-(3-nitrophenyl)oxazolidine, in organic chemistry.
Various applications
In organic chemistry This indicates that the compound has a range of potential uses, depending on the context and specific requirements of a given reaction or process.
Check Digit Verification of cas no
The CAS Registry Mumber 3394-30-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,9 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3394-30:
(6*3)+(5*3)+(4*9)+(3*4)+(2*3)+(1*0)=87
87 % 10 = 7
So 3394-30-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O3/c12-11(13)8-3-1-2-7(6-8)9-10-4-5-14-9/h1-3,6,9-10H,4-5H2
