3397-54-4 Usage
General Description
(±)-N-(tetrahydro-2,5-dioxo-3-furyl)acetamide, also known as sucramide, is a synthetic compound with the chemical formula C7H11NO4. It is commonly used as an intermediate in the production of pharmaceuticals and agrochemicals. Sucramide has been found to exhibit antifungal and antibacterial properties, making it useful in the development of new drugs for fighting fungal and bacterial infections. Additionally, sucramide has potential applications in the field of organic synthesis and medicinal chemistry due to its unique chemical structure. While its exact mechanisms of action and potential side effects are still being studied, (±)-N-(tetrahydro-2,5-dioxo-3-furyl)acetamide shows promise as a versatile and valuable compound in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3397-54-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,9 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3397-54:
(6*3)+(5*3)+(4*9)+(3*7)+(2*5)+(1*4)=104
104 % 10 = 4
So 3397-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO4/c1-3(8)7-4-2-5(9)11-6(4)10/h4H,2H2,1H3,(H,7,8)
