3398-28-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-Aminobenzoyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazine is used as a potential therapeutic agent for cancer treatment. 1-(4-Aminobenzoyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazine's chemical structure allows it to act as a cytotoxic agent, targeting and inhibiting the growth of cancer cells. It may induce DNA damage and apoptosis, leading to the destruction of cancerous cells.
Additionally, due to its chemical composition, 1-(4-Aminobenzoyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazine could be further investigated and developed for use in various drug delivery systems to enhance its bioavailability and therapeutic outcomes in cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 3398-28-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,9 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3398-28:
(6*3)+(5*3)+(4*9)+(3*8)+(2*2)+(1*8)=105
105 % 10 = 5
So 3398-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H21N3O3/c20-16-4-2-15(3-5-16)19(23)22-9-7-21(8-10-22)12-14-1-6-17-18(11-14)25-13-24-17/h1-6,11H,7-10,12-13,20H2