340319-91-7 Usage
Uses
Used in Pharmaceutical Applications:
1-NAPHTHALEN-1-YL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID serves as a valuable building block for the synthesis of complex molecules with biological activity. Its unique structure and functional groups contribute to the development of new pharmaceutical compounds with potential therapeutic applications.
Used in Inorganic Chemistry Studies:
As a ligand, 1-NAPHTHALEN-1-YL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID is utilized in coordinating metal ions, which is instrumental in inorganic chemistry research. This property allows for the exploration of its interactions with various metal ions and the potential formation of new inorganic complexes.
Used in Organic Synthesis:
1-NAPHTHALEN-1-YL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID's structure and functional groups make it a promising starting material for organic synthesis. It can be used to create new organic compounds with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Used in Materials Science Research:
1-NAPHTHALEN-1-YL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID's diverse functional groups and unique structure suggest its potential use in the development of new materials. Its properties may contribute to the creation of advanced materials with specific characteristics for use in various industries, such as electronics, energy, and environmental applications.
Check Digit Verification of cas no
The CAS Registry Mumber 340319-91-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,0,3,1 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 340319-91:
(8*3)+(7*4)+(6*0)+(5*3)+(4*1)+(3*9)+(2*9)+(1*1)=117
117 % 10 = 7
So 340319-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H13NO3/c17-14-8-11(15(18)19)9-16(14)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9H2,(H,18,19)/p-1/t11-/m1/s1
