3406-74-4 Usage
Uses
Used in Pharmaceutical Research:
TAPT is used as a building block for creating various pharmacologically active compounds. Its unique structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Enzyme Inhibition:
TAPT is used as an inhibitor for certain enzymes. Its ability to interact with specific enzymes can be utilized in the development of drugs that target these enzymes, potentially leading to treatments for various diseases and conditions.
Used in Coordination Chemistry:
TAPT is used as a ligand for metal ions in coordination chemistry. Its interaction with metal ions can be exploited to create new materials with potential applications in various industries, including pharmaceuticals, electronics, and materials science.
Used in Chemical Research:
TAPT is used in chemical research to study its properties and potential applications. Its unique structure and properties make it an interesting subject for research, which can lead to the discovery of new compounds and materials with various uses.
Check Digit Verification of cas no
The CAS Registry Mumber 3406-74-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,0 and 6 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3406-74:
(6*3)+(5*4)+(4*0)+(3*6)+(2*7)+(1*4)=74
74 % 10 = 4
So 3406-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO3S/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)
