340759-46-8

Usage

Uses

Used in Pharmaceutical Industry:
3-Pyridazinecarbonitrile,6-amino-(9CI) is used as a key intermediate in the synthesis of pharmaceuticals for its ability to form a wide range of biologically active compounds. Its presence in the molecular structure of various drugs contributes to their therapeutic effects, making it an essential component in the development of new medications.
Used in Agrochemical Industry:
In the agrochemical industry, 3-Pyridazinecarbonitrile,6-amino-(9CI) is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its unique chemical properties allow for the creation of effective and targeted agrochemicals that can protect crops and enhance agricultural productivity.
Used in Dye Production:
3-Pyridazinecarbonitrile,6-amino-(9CI) is also used in the production of dyes due to its ability to form colored compounds. Its incorporation into dye molecules results in a variety of shades and hues, making it a valuable component in the dye industry for creating a diverse range of colorants.
Used in Organic Synthesis:
As an important chemical in the field of organic synthesis, 3-Pyridazinecarbonitrile,6-amino-(9CI) is used as a building block for the synthesis of various organic compounds. Its reactivity and functional groups enable the formation of complex molecular structures, contributing to the advancement of organic chemistry and the development of new materials.
Precaution:
It is important to handle 3-Pyridazinecarbonitrile,6-amino-(9CI) with care, as it may pose health and environmental hazards if not handled properly. Proper safety measures, such as wearing protective gear and working in a well-ventilated area, should be taken to minimize potential risks associated with its use.

InChI:InChI=1/C5H4N4/c6-3-4-1-2-5(7)9-8-4/h1-2H,(H2,7,9)