3411-71-0 Usage
Uses
Used in Pharmaceutical Industry:
(5-AMINO-1H-BENZOIMIDAZOL-2-YL)-METHANOL is used as a pharmacological agent for its antiviral properties, offering potential in the development of treatments against viral infections. Its unique structure allows it to target specific viral mechanisms, providing a new avenue for antiviral drug discovery.
Used in Medicinal Chemistry Research:
In the realm of medicinal chemistry, (5-AMINO-1H-BENZOIMIDAZOL-2-YL)-METHANOL serves as a key compound for research into the development of new drugs. Its chemical properties and reactivity make it a valuable building block for the synthesis of novel therapeutic agents with potential applications in various medical conditions.
Used in Industrial Processes:
Due to its unique structure and reactivity, (5-AMINO-1H-BENZOIMIDAZOL-2-YL)-METHANOL may find applications in various industrial processes. Its potential uses could include the synthesis of specialty chemicals, the development of new materials, or as an intermediate in the production of other complex organic compounds.
While the specific applications and industries for (5-AMINO-1H-BENZOIMIDAZOL-2-YL)-METHANOL are still under investigation, its potential in the pharmaceutical and medicinal chemistry sectors is promising. As research progresses, further applications may be discovered, expanding the utility of (5-AMINO-1H-BENZOIMIDAZOL-2-YL)-METHANOL across different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 3411-71-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,1 and 1 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3411-71:
(6*3)+(5*4)+(4*1)+(3*1)+(2*7)+(1*1)=60
60 % 10 = 0
So 3411-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H10F2OS/c1-18-13-4-2-9(3-5-13)14(17)10-6-11(15)8-12(16)7-10/h2-8H,1H3
