34160-24-2 Usage
Uses
Used in Organic Synthesis:
2,5-dimethoxyfuran serves as a valuable reagent in organic synthesis, facilitating the formation of complex organic molecules. Its unique structure and functional groups make it a versatile building block for the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Reactions:
As a reagent, 2,5-dimethoxyfuran is utilized in various chemical reactions, such as oxidation, reduction, and substitution processes. Its presence can influence the reaction pathways and outcomes, making it a useful tool in the development of new synthetic methods and strategies.
Used in Medicinal Chemistry:
2,5-dimethoxyfuran has been studied for its potential medicinal properties, including its anti-inflammatory and antioxidant activities. Its unique structure and functional groups may contribute to its biological effects, making it a promising candidate for the development of new therapeutic agents.
Used in Biofuel Additives:
Due to its high energy density and low freezing point, 2,5-dimethoxyfuran has been proposed as a potential biofuel additive. Its incorporation into biofuel formulations could enhance the fuel's performance characteristics, such as energy content and cold-flow properties, making it a valuable component in the development of sustainable energy sources.
Check Digit Verification of cas no
The CAS Registry Mumber 34160-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,1,6 and 0 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 34160-24:
(7*3)+(6*4)+(5*1)+(4*6)+(3*0)+(2*2)+(1*4)=82
82 % 10 = 2
So 34160-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O3/c1-7-5-3-4-6(8-2)9-5/h3-4H,1-2H3
