342002-82-8 Usage
Description
4-Isopropoxycarbonylphenylboronic acid, also known as 4-(Isopropoxycarbonyl)benzeneboronic acid, is an organic compound that exists as a beige crystalline powder. It is a boronic acid derivative with an isopropoxycarbonyl group attached to the para position of the phenyl ring. 4-ISOPROPOXYCARBONYLPHENYLBORONIC ACID is known for its reactivity in various chemical reactions, particularly in the field of organic synthesis.
Uses
Used in Organic Synthesis:
4-Isopropoxycarbonylphenylboronic acid is used as an organic chemical synthesis intermediate for the preparation of various complex organic molecules. Its reactivity and functional groups make it a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Suzuki Reaction:
In the field of cross-coupling reactions, 4-Isopropoxycarbonylphenylboronic acid is employed as a key component in the Suzuki reaction. This reaction is a widely used method for the formation of carbon-carbon bonds, particularly in the synthesis of biaryl compounds, which are important structural motifs in many pharmaceuticals and natural products. The boronic acid derivative serves as a nucleophile, reacting with an aryl or vinyl halide or triflate in the presence of a palladium catalyst to form the desired biaryl product.
Used in Pharmaceutical Industry:
4-Isopropoxycarbonylphenylboronic acid is used as a building block in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity allow for the development of new drugs with improved potency, selectivity, and pharmacokinetic properties.
Used in Material Science:
In the field of material science, 4-Isopropoxycarbonylphenylboronic acid can be used as a precursor for the development of novel materials with specific properties, such as optoelectronic materials, polymers with tailored properties, and advanced coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 342002-82-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,2,0,0 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 342002-82:
(8*3)+(7*4)+(6*2)+(5*0)+(4*0)+(3*2)+(2*8)+(1*2)=88
88 % 10 = 8
So 342002-82-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3