34236-06-1 Usage
Uses
Used in Pharmaceutical Industry:
L-METHIONINE METHYLSULFONIUM IODIDE, 99% (99% E.E.) is used as a pharmaceutical intermediate for the synthesis of various drugs and medications, contributing to the development of novel therapeutic agents.
Used in Polymer Studies:
In the field of polymer science, L-METHIONINE METHYLSULFONIUM IODIDE, 99% (99% E.E.) is used in the study of polyelectrolytes, which are essential for understanding the properties and behavior of polymers in various applications, such as drug delivery systems, water treatment, and biomaterials.
Check Digit Verification of cas no
The CAS Registry Mumber 34236-06-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,2,3 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 34236-06:
(7*3)+(6*4)+(5*2)+(4*3)+(3*6)+(2*0)+(1*6)=91
91 % 10 = 1
So 34236-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2S.HI/c1-10(2)4-3-5(7)6(8)9;/h5H,3-4,7H2,1-2H3;1H