342405-27-0 Usage
Uses
Used in Pharmaceutical Industry:
(4-METHYL-2-PHENYL-5-PYRIMIDINYL)METHANOL is used as a pharmaceutical intermediate for the synthesis of various drugs, contributing to the development of new medications due to its unique chemical structure and potential biological activity.
Used in Research and Development:
In the pharmaceutical and chemical industries, (4-METHYL-2-PHENYL-5-PYRIMIDINYL)METHANOL is utilized in research and development efforts to explore its precise properties and potential applications, with a focus on enhancing drug discovery and improving therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 342405-27-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,2,4,0 and 5 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 342405-27:
(8*3)+(7*4)+(6*2)+(5*4)+(4*0)+(3*5)+(2*2)+(1*7)=110
110 % 10 = 0
So 342405-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O/c1-9-11(8-15)7-13-12(14-9)10-5-3-2-4-6-10/h2-7,15H,8H2,1H3
