34252-54-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Methyl-2H-indazole-3-carbaldehyde is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to be readily modified into a range of biologically active compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Chemistry:
As a versatile intermediate, 2-Methyl-2H-indazole-3-carbaldehyde is used in organic chemistry for the preparation of substituted indazoles and other heterocyclic compounds, which are important in the creation of complex organic molecules with specific properties.
Used in Material Science:
2-Methyl-2H-indazole-3-carbaldehyde is utilized in material science for the development of new materials with unique properties, such as those with enhanced stability or reactivity, due to its adaptable chemical structure.
Used in Agrochemicals:
In the agrochemical industry, 2-Methyl-2H-indazole-3-carbaldehyde is used as a starting material for the synthesis of compounds with pesticidal or herbicidal properties, contributing to the development of more effective and environmentally friendly agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 34252-54-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,2,5 and 2 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 34252-54:
(7*3)+(6*4)+(5*2)+(4*5)+(3*2)+(2*5)+(1*4)=95
95 % 10 = 5
So 34252-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O/c1-11-9(6-12)7-4-2-3-5-8(7)10-11/h2-6H,1H3
