34279-51-1 Usage
Description
(6R,7S)-7-[[(5R)-5-amino-5-carboxy-pentanoyl]amino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid is a complex chemical compound belonging to the class of beta-lactam antibiotics, structurally related to penicillins. It features a crucial beta-lactam ring for its antibiotic activity and is characterized by its molecular formula C15H19N3O8S.
Uses
Used in Pharmaceutical Industry:
(6R,7S)-7-[[(5R)-5-amino-5-carboxy-pentanoyl]amino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid is used as an antibiotic for treating bacterial infections, particularly those caused by Gram-positive bacteria such as Staphylococcus aureus and Streptococcus pneumoniae. Its unique structure and mechanism of action, which involves inhibiting the synthesis of bacterial cell walls, make it an important and effective antibiotic in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 34279-51-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,2,7 and 9 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 34279-51:
(7*3)+(6*4)+(5*2)+(4*7)+(3*9)+(2*5)+(1*1)=121
121 % 10 = 1
So 34279-51-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N4O9S.Na/c1-28-16(19-9(21)4-2-3-8(17)11(22)23)13(26)20-10(12(24)25)7(5-29-15(18)27)6-30-14(16)20;/h8,14H,2-6,17H2,1H3,(H2,18,27)(H,19,21)(H,22,23)(H,24,25);/q;+1/p-1/t8-,14-,16+;/m1./s1