3429-24-1 Usage
General Description
3-Amino-3-pyridin-4-yl-propionic acid is a chemical compound with the molecular formula C8H10N2O2. It is a derivative of pyridine and contains an amino group, a carboxylic acid group, and a propionic acid group. 3-AMINO-3-PYRIDIN-4-YL-PROPIONIC ACID is often used in organic synthesis and pharmaceutical research as a building block for the creation of other more complex molecules. It may also have potential applications in the development of new drugs or pharmaceuticals due to its unique structure and properties. This chemical has the potential to be a valuable tool in the field of medicinal and organic chemistry as it can be modified and utilized in various ways to create new and effective compounds for use in the medical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3429-24-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,2 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3429-24:
(6*3)+(5*4)+(4*2)+(3*9)+(2*2)+(1*4)=81
81 % 10 = 1
So 3429-24-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c9-7(5-8(11)12)6-1-3-10-4-2-6/h1-4,7H,5,9H2,(H,11,12)
