3429-24-1 Usage
Uses
Used in Organic Synthesis:
3-Amino-3-pyridin-4-yl-propionic acid is used as a key intermediate in organic synthesis for the creation of a variety of complex organic compounds. Its unique structure allows for multiple points of modification, making it a valuable component in the synthesis of new chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Amino-3-pyridin-4-yl-propionic acid is utilized as a building block for the development of new drugs and pharmaceuticals. Its distinctive properties and the ability to be modified in various ways contribute to its potential in creating novel and effective compounds for medical applications.
Used in Medicinal Chemistry:
3-Amino-3-pyridin-4-yl-propionic acid is employed as a valuable tool in medicinal chemistry, where it can be incorporated into the design and synthesis of new therapeutic agents. Its presence in a molecule can influence pharmacokinetic and pharmacodynamic properties, enhancing the drug's efficacy and safety profile.
Overall, 3-Amino-3-pyridin-4-yl-propionic acid is a multifaceted chemical entity with broad applications across different scientific disciplines, particularly in the realms of organic synthesis, pharmaceutical research, and medicinal chemistry, where it plays a crucial role in the innovation of new chemical and pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 3429-24-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,2 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3429-24:
(6*3)+(5*4)+(4*2)+(3*9)+(2*2)+(1*4)=81
81 % 10 = 1
So 3429-24-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c9-7(5-8(11)12)6-1-3-10-4-2-6/h1-4,7H,5,9H2,(H,11,12)
