3430-25-9 Usage
General Description
2,3,5-Tribromo-4-methylpyridine is a chemical compound with the molecular formula C6H4Br3N. It is a pyridine derivative with three bromine atoms and a methyl group attached to the pyridine ring. This chemical is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and functional materials. Its unique structure and properties make it a valuable building block in organic synthesis and medicinal chemistry. 2,3,5-Tribromo-4-methylpyridine is also known for its stability and low reactivity, making it a valuable tool in various chemical reactions and processes. Due to its versatility and potential applications, this compound is of interest to researchers and industries in the fields of chemistry, pharmaceuticals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 3430-25-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,3 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3430-25:
(6*3)+(5*4)+(4*3)+(3*0)+(2*2)+(1*5)=59
59 % 10 = 9
So 3430-25-9 is a valid CAS Registry Number.
InChI:InChI=1S/C6H4Br3N/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3
