34330-15-9 Usage
General Description
2-Thioxo-3-allyl-2,4-oxo-5-(N-methyl-pyrid-2-ylidene)-1,3-thiazoldine is a chemical compound with a complex structure containing thiazolidine, allyl, and pyridine moieties. It is a thiazolidine derivative with a thioxo group and an allyl group attached to the thiazolidine ring, as well as a pyridine ring attached to the nitrogen atom. 2-THIOXO-3-ALLYL-2-4-OXO-5-(N-METHYL-PYRID-2-YLIDEN)-1,3-THIAZOLDINE may have potential pharmaceutical or biological applications due to its unique structure and functional groups. Further research is necessary to determine its specific properties and potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 34330-15-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,3,3 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 34330-15:
(7*3)+(6*4)+(5*3)+(4*3)+(3*0)+(2*1)+(1*5)=79
79 % 10 = 9
So 34330-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2OS2/c1-3-7-14-11(15)10(17-12(14)16)9-6-4-5-8-13(9)2/h3-6,8H,1,7H2,2H3/b10-9-