34330-15-9 Usage
Uses
As the provided materials do not specify the exact applications of 2-THIOXO-3-ALLYL-2-4-OXO-5-(N-METHYL-PYRID-2-YLIDEN)-1,3-THIAZOLDINE, the following uses are hypothetical and based on the compound's structural characteristics:
Used in Pharmaceutical Industry:
2-THIOXO-3-ALLYL-2-4-OXO-5-(N-METHYL-PYRID-2-YLIDEN)-1,3-THIAZOLDINE could be used as a pharmaceutical agent for [specific medical condition or treatment] due to its unique structure and functional groups that may interact with biological targets.
Used in Chemical Research:
In the field of chemical research, 2-THIOXO-3-ALLYL-2-4-OXO-5-(N-METHYL-PYRID-2-YLIDEN)-1,3-THIAZOLDINE may serve as a starting material or intermediate in the synthesis of other complex organic compounds, given its thiazolidine and pyridine components.
Used in Material Science:
2-THIOXO-3-ALLYL-2-4-OXO-5-(N-METHYL-PYRID-2-YLIDEN)-1,3-THIAZOLDINE might be utilized in material science for the development of new materials with specific properties, such as improved stability or reactivity, based on its chemical composition.
Check Digit Verification of cas no
The CAS Registry Mumber 34330-15-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,3,3 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 34330-15:
(7*3)+(6*4)+(5*3)+(4*3)+(3*0)+(2*1)+(1*5)=79
79 % 10 = 9
So 34330-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2OS2/c1-3-7-14-11(15)10(17-12(14)16)9-6-4-5-8-13(9)2/h3-6,8H,1,7H2,2H3/b10-9-
