343349-20-2 Usage
Uses
Used in Pharmaceutical Research:
4-chloro-2-phenylpyrimidine-5-carboxylic acid is utilized as a key intermediate in the development of antiviral and anticancer drugs. Its unique structure allows it to be a promising candidate for the creation of new therapeutic agents targeting various diseases.
Used in Organic Synthesis:
In the field of organic synthesis, 4-chloro-2-phenylpyrimidine-5-carboxylic acid serves as a valuable building block. It can be used to construct more complex organic molecules, contributing to the advancement of chemical research and the development of novel compounds with diverse applications.
As ongoing research continues, the full potential and applications of 4-chloro-2-phenylpyrimidine-5-carboxylic acid may expand, revealing new opportunities for its use across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 343349-20-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,3,3,4 and 9 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 343349-20:
(8*3)+(7*4)+(6*3)+(5*3)+(4*4)+(3*9)+(2*2)+(1*0)=132
132 % 10 = 2
So 343349-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClN2O2/c12-9-8(11(15)16)6-13-10(14-9)7-4-2-1-3-5-7/h1-6H,(H,15,16)
