3438-78-6 Usage
Uses
Used in Chemical Reactions and Organic Synthesis:
(5-hydrazinyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraen-2-yl) hydrazine is used as a reactive intermediate for various chemical reactions and organic synthesis processes. Its high reactivity allows it to participate in a wide range of chemical transformations, making it a valuable component in the synthesis of complex organic molecules.
Used in Coordination Chemistry:
In the field of coordination chemistry, (5-hydrazinyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraen-2-yl) hydrazine is used as a ligand to form coordination complexes. Its ability to chelate with metal ions provides opportunities for the development of new coordination compounds with potential applications in catalysis, materials science, and other areas.
Used in Pharmaceutical Sciences:
(5-hydrazinyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraen-2-yl) hydrazine may have potential biological activities, making it an interesting target for research in pharmaceutical sciences. Its unique structure and reactivity could lead to the discovery of new drugs or drug candidates with novel mechanisms of action.
Used in Chemical Research:
Due to its high reactivity and potential for forming coordination complexes, (5-hydrazinyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraen-2-yl) hydrazine is used as a subject of study in chemical research. Further investigation into its properties and reactivity could contribute to the advancement of chemical science and the development of new applications for (5-hydrazinyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraen-2-yl) hydrazine.
Check Digit Verification of cas no
The CAS Registry Mumber 3438-78-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,3 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3438-78:
(6*3)+(5*4)+(4*3)+(3*8)+(2*7)+(1*8)=96
96 % 10 = 6
So 3438-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N8/c6-10-4-2-3(9-1-8-2)5(11-7)13-12-4/h1H,6-7H2,(H,8,9)(H,10,12)(H,11,13)
