3438-80-0 Usage
Uses
Given the provided materials, there are no explicit uses listed for 4-(butylsulfanyl)-1H-imidazo[4,5-d]pyridazin-7-yl hydrosulfide. However, based on its chemical structure and classification as an imidazole derivative, it can be inferred that it may have potential applications in various fields such as:
Used in Pharmaceutical Industry:
4-(butylsulfanyl)-1H-imidazo[4,5-d]pyridazin-7-yl hydrosulfide could be used as a pharmaceutical intermediate for the synthesis of drugs with potential therapeutic effects. Its unique structure may allow it to interact with biological targets, making it a candidate for drug development.
Used in Chemical Research:
In the field of chemical research, 4-(butylsulfanyl)-1H-imidazo[4,5-d]pyridazin-7-yl hydrosulfide may serve as a subject for studying the reactivity of sulfur and nitrogen-containing compounds, potentially leading to the discovery of new reaction pathways or mechanisms.
Used in Material Science:
4-(butylsulfanyl)-1H-imidazo[4,5-d]pyridazin-7-yl hydrosulfide might also find applications in material science, where its specific chemical properties could be harnessed to develop new materials with unique characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 3438-80-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,3 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3438-80:
(6*3)+(5*4)+(4*3)+(3*8)+(2*8)+(1*0)=90
90 % 10 = 0
So 3438-80-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N4S2/c1-2-3-4-15-9-7-6(10-5-11-7)8(14)12-13-9/h5,13H,2-4H2,1H3,(H,12,14)
