3438-86-6 Usage
Uses
Used in Pharmaceutical Research:
2-[(3,4-dichlorophenyl)methylsulfanyl]-3,4,7,9-tetrazabicyclo[4.3.0]nonane-1,6,8-triene-5-thione is used as a research compound for exploring its potential medicinal properties. Given the presence of sulfur and nitrogen atoms, as well as the chlorine-substituted benzene ring, 2-[(3,4-dichlorophenyl)methylsulfanyl]-3,4,7,9-tetrazabicyclo[4.3.0]no na-1,6,8-triene-5-thione may exhibit bioactivity that could be harnessed for therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 2-[(3,4-dichlorophenyl)methylsulfanyl]-3,4,7,9-tetrazabicyclo[4.3.0]nonane-1,6,8-triene-5-thione is utilized to study its reactivity and behavior in various chemical reactions. Its unique structure allows researchers to investigate its potential as a precursor or intermediate in the synthesis of other complex organic molecules.
Used in Synthetic Organic Chemistry:
As a building block in synthetic organic chemistry, 2-[(3,4-dichlorophenyl)methylsulfanyl]-3,4,7,9-tetrazabicyclo[4.3.0]nonane-1,6,8-triene-5-thione is employed to construct more complex organic compounds. Its specific molecular features make it a valuable component in the development of novel chemical entities with potential applications in various industries.
Used in Research and Development:
Due to its intricate structure, 2-[(3,4-dichlorophenyl)methylsulfanyl]-3,4,7,9-tetrazabicyclo[4.3.0]nonane-1,6,8-triene-5-thione is used in research and development to explore its specific, targeted uses. This may include its application in the creation of new materials, pharmaceuticals, or other specialized chemical products that require its unique molecular attributes.
Check Digit Verification of cas no
The CAS Registry Mumber 3438-86-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,3 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3438-86:
(6*3)+(5*4)+(4*3)+(3*8)+(2*8)+(1*6)=96
96 % 10 = 6
So 3438-86-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H8Cl2N4S2/c13-7-2-1-6(3-8(7)14)4-20-12-10-9(15-5-16-10)11(19)17-18-12/h1-3,5,18H,4H2,(H,17,19)
