344-16-1 Usage
Uses
Used in Organic Synthesis:
6-Bromo-1-fluoro-2,4-dimethylbenzene is used as an intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 6-Bromo-1-fluoro-2,4-dimethylbenzene is utilized as a starting material or intermediate in the development of new drugs. Its halogenated aromatic structure can be incorporated into drug molecules to modulate their properties, such as solubility, stability, and biological activity.
Used in Agrochemical Production:
6-Bromo-1-fluoro-2,4-dimethylbenzene has potential applications in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties can be exploited to create active ingredients that target specific pests or weeds, improving the efficiency and selectivity of these products.
Used in Specialty Chemicals:
6-Bromo-1-fluoro-2,4-dimethylbenzene also finds use in the production of specialty chemicals, which are high-value chemicals used in various industries, such as coatings, adhesives, and plastics. The unique structure of 6-Bromo-1-fluoro-2,4-dimethylbenzene can contribute to the performance characteristics of these specialty chemicals.
Safety Considerations:
Check Digit Verification of cas no
The CAS Registry Mumber 344-16-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,4 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 344-16:
(5*3)+(4*4)+(3*4)+(2*1)+(1*6)=51
51 % 10 = 1
So 344-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrF/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,1-2H3
