34414-83-0 Usage
General Description
(L)-ornithine 2-oxoglutarate is a chemical compound consisting of two amino acids, ornithine and 2-oxoglutarate. Ornithine is a non-essential amino acid that plays a crucial role in the urea cycle, which is responsible for removing excess nitrogen from the body. 2-oxoglutarate, also known as alpha-ketoglutarate, is an important intermediate in the Krebs cycle, a series of chemical reactions that generates energy in cells. When combined, (L)-ornithine 2-oxoglutarate is believed to have potential benefits in promoting muscle growth and recovery. It is often used as a supplement by athletes and bodybuilders to enhance athletic performance and reduce muscle fatigue. Additionally, it may have potential therapeutic applications in supporting liver and kidney function, as well as in wound healing and tissue repair.
Check Digit Verification of cas no
The CAS Registry Mumber 34414-83-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,1 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 34414-83:
(7*3)+(6*4)+(5*4)+(4*1)+(3*4)+(2*8)+(1*3)=100
100 % 10 = 0
So 34414-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/m0./s1
