34424-15-2 Usage
Uses
Used in Chemical Synthesis:
(+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 is used as a catalyst in chemical synthesis for its ability to facilitate various organic reactions. The presence of palladium, a well-known catalyst, and the specific structure of (+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 contribute to its unique reactivity and selectivity in certain chemical transformations.
Used in Catalysis Industry:
In the catalysis industry, (+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 is utilized as a catalyst to enhance the efficiency and selectivity of chemical reactions. Its unique molecular structure allows for targeted interactions with reactants, leading to improved outcomes in catalytic processes.
Used in Pharmaceutical Industry:
(+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 may be employed in the pharmaceutical industry as a catalyst for the synthesis of complex organic molecules, including potential drug candidates. Its unique properties can contribute to the development of novel and more effective medications.
Used in Environmental Applications:
In environmental applications, (+)-DI-MU-CHLOROBIS(2-(1-(DIMETHYLAMINO)-ETHYL)PHENYL-C,N)DIPALLADIUM, 98 can be used as a catalyst to facilitate the breakdown of pollutants or the synthesis of environmentally friendly compounds. Its catalytic properties can help address environmental challenges by promoting cleaner chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 34424-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,2 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 34424-15:
(7*3)+(6*4)+(5*4)+(4*2)+(3*4)+(2*1)+(1*5)=92
92 % 10 = 2
So 34424-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H26N2.2ClH.2Pd/c1-15(21(3)4)17-9-7-11-19(13-17)20-12-8-10-18(14-20)16(2)22(5)6;;;;/h7-12,15-16H,1-6H3;2*1H;;/q;;;2*+1/p-2/t15-,16+;;;;/rC20H26Cl2N2Pd2/c1-13-15-9-7-11-17(19(15)25(21)23(13,3)4)18-12-8-10-16-14(2)24(5,6)26(22)20(16)18/h7-14H,1-6H3/t13-,14+
