344325-95-7 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
5-Pyrimidinecarboxylicacid,2-methoxy-(9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a versatile building block for the development of new drugs with potential therapeutic applications.
Used in Organic Chemistry:
As a heterocyclic aromatic carboxylic acid, 5-Pyrimidinecarboxylicacid,2-methoxy-(9CI) is employed in organic chemistry for the synthesis of complex organic molecules and the modification of existing compounds. Its reactivity and functional groups allow for a wide range of chemical reactions, making it a valuable tool in the field of organic synthesis.
Used in the Synthesis of Novel Pharmaceuticals:
5-Pyrimidinecarboxylicacid,2-methoxy-(9CI) is used as a starting material for the development of new drugs. Its potential biological activity and ability to be modified through various chemical reactions make it an attractive candidate for the creation of innovative pharmaceutical agents with unique mechanisms of action and therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 344325-95-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,4,3,2 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 344325-95:
(8*3)+(7*4)+(6*4)+(5*3)+(4*2)+(3*5)+(2*9)+(1*5)=137
137 % 10 = 7
So 344325-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-11-6-7-2-4(3-8-6)5(9)10/h2-3H,1H3,(H,9,10)
