34435-70-6 Usage
Uses
Used in Analytical Chemistry:
1-(3-Furanyl)-1-hydroxy-4-pentanone is used as an analyte in the analytical study of comparative studies on aroma components in purple potato wine during aging. Its unique chemical structure allows for the investigation of its role in the development of the wine's aroma profile and the changes that occur over time.
Used in Flavor and Fragrance Industry:
1-(3-Furanyl)-1-hydroxy-4-pentanone can be used as a flavoring agent or a fragrance ingredient due to its potential aromatic properties. Its unique scent profile may contribute to the creation of novel and distinct flavors or fragrances in various consumer products.
Used in Pharmaceutical Research:
Given its chemical structure, 1-(3-Furanyl)-1-hydroxy-4-pentanone may have potential applications in pharmaceutical research, particularly in the development of new drugs or drug delivery systems. Its furan and hydroxyl functional groups could be exploited for interactions with biological targets or as part of drug synthesis processes.
Used in Material Science:
1-(3-Furanyl)-1-hydroxy-4-pentanone may also find use in material science, where its unique properties could be leveraged to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 34435-70-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,3 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 34435-70:
(7*3)+(6*4)+(5*4)+(4*3)+(3*5)+(2*7)+(1*0)=106
106 % 10 = 6
So 34435-70-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H12O3/c1-7(10)2-3-9(11)8-4-5-12-6-8/h4-6,9,11H,2-3H2,1H3
