34446-34-9 Usage
Molecular structure
A complex structure featuring a naphtho[2,1,8-mna]xanthene core with a methoxy and phenyl group attached to specific positions.
Classification
A xanthene derivative.
Usage
Commonly used as a fluorescent dye in biological and chemical research for labeling and detection purposes.
Photophysical properties
Possesses unique photophysical properties and a high fluorescence quantum yield, making it suitable for potential optoelectronic applications.
Antimicrobial properties
Has been studied for its potential antimicrobial and antifungal properties.
Scientific and industrial applications
The diverse chemical and physical properties of 1-methoxy-2-phenyl-3H-naphtho[2,1,8-mna]xanthen-3-one make it a valuable tool for various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 34446-34-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,4 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 34446-34:
(7*3)+(6*4)+(5*4)+(4*4)+(3*6)+(2*3)+(1*4)=109
109 % 10 = 9
So 34446-34-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H16O3/c1-28-26-19-12-11-17-16-9-5-6-10-20(16)29-21-14-13-18(23(19)24(17)21)25(27)22(26)15-7-3-2-4-8-15/h2-14H,1H3