344790-87-0 Usage
Uses
Used in Extractive Distillation:
1-Butyl-3-methylimidazolium thiocyanate is used as an alternative to conventional entrainers in the extractive distillation of cyclohexane and benzene. Its unique properties allow for improved separation efficiency and reduced energy consumption in the process.
Used in Electrolyte Solutions:
In the polyethylene oxide-sodium perchlorate electrolyte, [BMIM][SCN] is used to increase its ionic conductivity at room temperature. The presence of the polarizable thiocyanate anion enhances the overall performance of the electrolyte, making it suitable for various electrochemical applications.
Used in Lithium-ion Batteries:
1-Butyl-3-methylimidazolium thiocyanate demonstrates a higher degree of solubility for lithium salts such as lithium perchlorate (LiClO4) and N-lithiotrifluoromethanesulfonimide (LiTFSI) when compared to other room temperature ionic liquids. This makes it an attractive candidate for use in lithium-ion batteries, where it can improve the performance and efficiency of the battery system.
Used in Other Industries:
Given the versatile nature of 1-Butyl-3-methylimidazolium thiocyanate, it is likely to find applications in other industries as well, such as in chemical synthesis, gas separation, and energy storage systems. Its unique properties and potential for customization make it a promising compound for further research and development in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 344790-87-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,4,7,9 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 344790-87:
(8*3)+(7*4)+(6*4)+(5*7)+(4*9)+(3*0)+(2*8)+(1*7)=170
170 % 10 = 0
So 344790-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N2.CHNS/c1-3-4-5-10-7-6-9(2)8-10;2-1-3/h6-8H,3-5H2,1-2H3;3H/q+1;/p-1
