34491-29-7 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-CHLORO-PHENYL)-THIAZOLIDINE-4-CARBOXYLIC ACID is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique chemical structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Industry:
In the chemical industry, 2-(4-CHLORO-PHENYL)-THIAZOLIDINE-4-CARBOXYLIC ACID is utilized as a building block for the synthesis of complex organic compounds. Its versatile structure makes it suitable for the creation of a wide range of chemical products, including specialty chemicals, agrochemicals, and advanced materials.
Used in Drug Development Research:
2-(4-CHLORO-PHENYL)-THIAZOLIDINE-4-CARBOXYLIC ACID is employed as a research compound in the field of drug development. Its unique properties and structural features make it an attractive candidate for the design and synthesis of novel therapeutic agents with potential applications in various medical conditions.
Used in Material Science:
In the field of material science, 2-(4-CHLORO-PHENYL)-THIAZOLIDINE-4-CARBOXYLIC ACID is used as a component in the development of new materials with specific properties. Its incorporation into polymers, coatings, or other materials can result in enhanced performance characteristics, such as improved stability, reactivity, or selectivity.
Overall, the diverse applications of 2-(4-CHLORO-PHENYL)-THIAZOLIDINE-4-CARBOXYLIC ACID across various industries highlight its potential as a versatile and valuable chemical compound with significant research and development prospects.
Check Digit Verification of cas no
The CAS Registry Mumber 34491-29-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,9 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 34491-29:
(7*3)+(6*4)+(5*4)+(4*9)+(3*1)+(2*2)+(1*9)=117
117 % 10 = 7
So 34491-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)