345-22-2 Usage
Uses
Used in Pesticide Production:
Benzene, 1-fluoro-2,4-dimethyl-5-nitro-, is used as a chemical intermediate in the production of pesticides. Its unique structure and properties contribute to the development of effective and targeted pest control agents.
Used in Pharmaceutical Manufacturing:
This chemical compound is also utilized in the pharmaceutical industry as a building block for the synthesis of various drugs. Its presence in the molecular structure of certain medications can enhance their therapeutic effects and properties.
Used in Other Industrial Applications:
Beyond its applications in pesticides and pharmaceuticals, Benzene, 1-fluoro-2,4-dimethyl-5-nitro-, finds use in other industrial sectors. Its versatility as a chemical intermediate allows for its incorporation into a wide range of products, from dyes to plastics, depending on the specific requirements of each industry.
It is crucial to note that due to the potential health hazards associated with Benzene, 1-fluoro-2,4-dimethyl-5-nitro-, strict safety protocols and protective measures should be implemented during its production, handling, and use to minimize exposure and mitigate the risk of adverse health effects.
Check Digit Verification of cas no
The CAS Registry Mumber 345-22-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,4 and 5 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 345-22:
(5*3)+(4*4)+(3*5)+(2*2)+(1*2)=52
52 % 10 = 2
So 345-22-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FNO2/c1-5-3-6(2)8(10(11)12)4-7(5)9/h3-4H,1-2H3
