345264-61-1 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-1,2,3,4-tetrahydroquinoline hydrochloride is used as a reagent for the synthesis of fused tricyclic heterocycle piperazine (piperidine) derivatives. These derivatives have potential applications as multireceptor atypical antipsychotics, which are important for the development of novel treatments for psychiatric disorders.
In the synthesis process, 5-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride plays a crucial role in the formation of the desired tricyclic heterocycle structures, which are believed to possess unique pharmacological properties. The incorporation of the fluorine atom and the tetrahydroquinoline ring into these derivatives may contribute to their ability to modulate multiple neurotransmitter receptors, leading to improved efficacy and reduced side effects compared to traditional antipsychotic medications.
Overall, 5-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride is a valuable chemical intermediate in the development of innovative antipsychotic drugs, with the potential to address unmet medical needs and improve patient outcomes in the treatment of various psychiatric conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 345264-61-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,5,2,6 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 345264-61:
(8*3)+(7*4)+(6*5)+(5*2)+(4*6)+(3*4)+(2*6)+(1*1)=141
141 % 10 = 1
So 345264-61-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H10FN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,4-5,11H,2-3,6H2
