34545-22-7 Usage
Description
2-NITRO-3-AMINO-4-METHYL-5-BROMOBENZOIC ACID is a chemical compound with a molecular formula C8H7BrN2O4, belonging to the benzoic acid derivatives. It features a nitro, amino, methyl, and bromo group, which contribute to its unique chemical structure and properties. 2-NITRO-3-AMINO-4-METHYL-5-BROMOBENZOIC ACID is significant in the field of organic chemistry and drug development due to its potential applications in the synthesis of various pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Synthesis:
2-NITRO-3-AMINO-4-METHYL-5-BROMOBENZOIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a versatile building block for the development of new drugs with potential therapeutic applications.
Used in Organic Chemistry:
In the field of organic chemistry, 2-NITRO-3-AMINO-4-METHYL-5-BROMOBENZOIC ACID serves as a valuable compound for the synthesis of various organic compounds. Its presence of different functional groups enables it to participate in a wide range of chemical reactions, contributing to the advancement of organic chemistry.
Used in Drug Development:
2-NITRO-3-AMINO-4-METHYL-5-BROMOBENZOIC ACID is utilized in drug development for its potential applications in creating new therapeutic agents. Its unique properties and reactivity make it a promising candidate for the design and synthesis of innovative drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 34545-22-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,5,4 and 5 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34545-22:
(7*3)+(6*4)+(5*5)+(4*4)+(3*5)+(2*2)+(1*2)=107
107 % 10 = 7
So 34545-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN2O4/c1-3-5(9)2-4(8(12)13)7(6(3)10)11(14)15/h2H,10H2,1H3,(H,12,13)
