34550-49-7 Usage
Uses
Used in Chemical Industry:
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure and properties allow it to be a versatile building block in the development of new chemical products.
Used in Pharmaceutical Industry:
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine is used as a potential pharmaceutical candidate due to its heterocyclic nature. It may be utilized in the development of new drugs targeting specific biological pathways or receptors, contributing to the discovery of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 34550-49-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,5,5 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 34550-49:
(7*3)+(6*4)+(5*5)+(4*5)+(3*0)+(2*4)+(1*9)=107
107 % 10 = 7
So 34550-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN4/c6-3-1-2-7-5-4(3)8-10-9-5/h1-2,4H
