34581-92-5 Usage
Uses
Used in Pharmaceutical Industry:
1-Acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one is used as a building block for the synthesis of various pharmaceuticals due to its antimicrobial and antifungal properties. It plays a crucial role in the development of new drugs that can effectively combat infections and diseases caused by harmful microorganisms.
Used in Agrochemical Industry:
In the agrochemical industry, 1-acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one is utilized as a key component in the formulation of pesticides. Its antimicrobial and antifungal properties make it an effective agent in controlling pests and diseases that affect crops, thereby contributing to increased agricultural productivity.
Used in Food and Beverage Industry:
1-Acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one has been studied for its potential use as a flavor and fragrance ingredient in the food and beverage industry. Its unique properties may contribute to the enhancement of taste and aroma profiles in various food products, offering new possibilities for product innovation and consumer appeal.
Overall, 1-acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one is a versatile compound with a wide range of potential applications across different industries, including pharmaceuticals, agrochemicals, and food and beverage. Its antimicrobial and antifungal properties, along with its use as a building block in the synthesis of various compounds, make it a valuable asset in the development of innovative products and solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 34581-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,5,8 and 1 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34581-92:
(7*3)+(6*4)+(5*5)+(4*8)+(3*1)+(2*9)+(1*2)=125
125 % 10 = 5
So 34581-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c1-5-3-7(10)8(4-5)6(2)9/h3H,4H2,1-2H3
Xi:Irritant;
