34600-55-0 Usage
Uses
Used in Pharmaceutical Industry:
1-Vinyl-1 H-pyrrole-2-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and functional groups allow for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 1-Vinyl-1 H-pyrrole-2-carboxylic acid is used as a building block for the synthesis of agrochemicals. Its reactivity and functional groups enable the creation of new compounds with potential applications in agriculture, such as pesticides and herbicides.
Used in Dye Industry:
1-Vinyl-1 H-pyrrole-2-carboxylic acid is used as a starting material in the production of dyes. Its ability to form various chemical bonds and its functional groups contribute to the development of new dyes with specific color properties and applications.
Used in Polymer and Copolymer Production:
As a building block, 1-Vinyl-1 H-pyrrole-2-carboxylic acid is used in the production of polymers and copolymers. Its versatile reactivity and functional groups allow for the creation of new polymeric materials with specific properties, such as improved strength, flexibility, or chemical resistance.
Used in Materials Science:
1-Vinyl-1 H-pyrrole-2-carboxylic acid has potential applications in materials science, particularly in the development of conductive polymers and organic electronics. Its unique structure and functional groups make it a promising candidate for the creation of new materials with specific electronic properties and applications.
Overall, 1-Vinyl-1 H-pyrrole-2-carboxylic acid is a versatile chemical compound with a wide range of applications across various industries, including pharmaceuticals, agrochemicals, dyes, polymers, and materials science. Its unique structure and functional groups make it a valuable building block for the development of new molecules and materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 34600-55-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,6,0 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 34600-55:
(7*3)+(6*4)+(5*6)+(4*0)+(3*0)+(2*5)+(1*5)=90
90 % 10 = 0
So 34600-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO2/c1-2-8-5-3-4-6(8)7(9)10/h2-5H,1H2,(H,9,10)/p-1
