3463-93-2 Usage
Uses
1. Used in Pharmaceutical Industry:
Pericalline is used as a pharmaceutical compound for its potential therapeutic properties. The alkaloid is derived from various plant sources, which may contribute to the development of new drugs or treatments for various medical conditions.
2. Used in Research and Development:
Pericalline is utilized as a research compound for studying its chemical properties, structural characteristics, and potential interactions with other molecules. This can help scientists understand its mechanisms of action and explore its possible applications in medicine and other fields.
3. Used in Traditional Medicine:
As pericalline is found in plants that have been used in traditional medicine, it may be used as a component in the development of traditional remedies or herbal formulations for specific health conditions.
4. Used in Chemical Synthesis:
Due to its unique chemical structure, pericalline may be employed as a starting material or intermediate in the synthesis of other complex organic compounds, potentially leading to the creation of new pharmaceuticals or chemical products.
References
Renner, Kernweisz., Experientia, 19, 244 (1963)
Svoboda, Oliver, Bedwell., Lloydia, 26, 141 (1963)
Blomster et al., ibid, 27, 480 (1964)
Check Digit Verification of cas no
The CAS Registry Mumber 3463-93-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,6 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3463-93:
(6*3)+(5*4)+(4*6)+(3*3)+(2*9)+(1*3)=92
92 % 10 = 2
So 3463-93-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2/c1-3-13-10-20-9-8-14(13)12(2)18-16(11-20)15-6-4-5-7-17(15)19-18/h3-7,14,19H,2,8-11H2,1H3/b13-3+
