34686-71-0 Usage
Uses
Used in Food and Beverage Industry:
2H-PYRAN-2-ONE, TETRAHYDRO-6-(2-PENTENYL) is used as a flavoring agent for its fruity aroma, enhancing the taste and smell of various food and beverage products.
Used in Fragrance Production:
In the fragrance industry, 2H-PYRAN-2-ONE, TETRAHYDRO-6-(2-PENTENYL) serves as a key component in creating diverse scents, capitalizing on its unique fruity odor to contribute to the overall composition of fragrances.
Used as a Pharmaceutical Intermediate:
2H-PYRAN-2-ONE, TETRAHYDRO-6-(2-PENTENYL) is utilized as an intermediate in the synthesis of pharmaceuticals, playing a crucial role in the development of new medications and contributing to advancements in healthcare.
Used in Organic Compound Synthesis:
This chemical compound is also employed as an intermediate in the synthesis of other organic compounds, highlighting its importance in the field of organic chemistry and the production of various chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 34686-71-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,6,8 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 34686-71:
(7*3)+(6*4)+(5*6)+(4*8)+(3*6)+(2*7)+(1*1)=140
140 % 10 = 0
So 34686-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h3-4,9H,2,5-8H2,1H3
