347146-27-4

Usage

Uses

Used in Pharmaceutical Research:
2-[(Phenylmethyl)thio]-pyridine-4-carboxamide is used as a research compound for exploring its potential applications in the pharmaceutical industry. Its unique structural properties may contribute to the development of new drugs or therapeutic agents. However, further research and testing are required to determine its safety, efficacy, and potential uses in this field.

InChI:InChI=1/C13H12N2OS/c14-13(16)11-6-7-15-12(8-11)17-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,14,16)

Upstream product

• 6313-54-8 2-chloroisonicotinic acid, 
• 3492-66-8 benzyl-disulfane 

Relevant academic research and scientific papers

Sulfonamide-containing heterocyclic compounds

The present invention provides a sulfonamide- or sulfonylurea-containing heterocyclic compounds. Specifically, it provides a heterocyclic compound represented by the formula (I), a pharmacologically acceptable salt thereof or a hydrate of them. In the formula, A is hydrogen atom, a halogen atom, a C1-C4 alkyl or alkoxy group which may be substituted with a halogen atom, or cyano group; B is an optionally substituted aryl group or monocyclic heteroaryl group, or: (wherein, the ring Q is an aromatic ring which may have nitrogen atom; and the ring M is a ring sharing a double bond with the ring Q, which ring may have a heteroatom; and the rings Q and M may share nitrogen atom); K is a single bond; T, W, X and Y are the same as or different from each other and each is ═C(D)— (wherein, D is hydrogen or a halogen atom) or nitrogen atom; U and V are the same as or different from each other and each is ═C(D)—, nitrogen atom, —CH2—, oxygen atom or —CO—; Z is a single bond or —CO—NH—; and R1 is hydrogen atom, etc.