34745-96-5 Usage
Uses
Used in Pharmaceutical Industry:
3-[2-(dimethylamino)ethoxy]-N,N-dimethylpropylamine serves as a crucial building block in the production of various drugs. Its unique structure allows it to be integrated into the synthesis of medications aimed at treating a multitude of health conditions, making it an indispensable component in the development of new pharmaceuticals.
Used in Agrochemical Synthesis:
In the agrochemical sector, 3-[2-(dimethylamino)ethoxy]-N,N-dimethylpropylamine is employed as an intermediate for the synthesis of compounds that contribute to crop protection and enhancement of agricultural yields. Its role in creating effective agrochemicals underscores its importance in this industry.
Used as an Intermediate in Organic Compounds Synthesis:
Beyond its applications in pharmaceuticals and agrochemicals, 3-[2-(dimethylamino)ethoxy]-N,N-dimethylpropylamine is also used in the synthesis of other organic compounds. Its ability to participate in a variety of chemical reactions makes it a valuable asset in organic chemistry for creating new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 34745-96-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,7,4 and 5 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 34745-96:
(7*3)+(6*4)+(5*7)+(4*4)+(3*5)+(2*9)+(1*6)=135
135 % 10 = 5
So 34745-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H22N2O/c1-10(2)6-5-8-12-9-7-11(3)4/h5-9H2,1-4H3
