3479-85-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2,5-DIBROMOADIPIC ACID is used as an intermediate in the pharmaceutical industry for the synthesis of various drugs. Its unique chemical structure allows for the development of new medications with potential therapeutic benefits.
Used in Agrochemical Production:
In the agrochemical sector, 2,5-DIBROMOADIPIC ACID serves as a crucial intermediate in the production of pesticides and other agricultural chemicals. Its properties contribute to the effectiveness and stability of these products, enhancing crop protection and yield.
Used in Flame Retardant Manufacturing:
2,5-DIBROMOADIPIC ACID is utilized in the creation of flame retardants, which are essential for improving the fire safety of various materials and products. Its bromine content plays a significant role in the flame-retardant properties of these compounds.
Used in Corrosion Inhibitor Development:
In the field of corrosion inhibition, 2,5-DIBROMOADIPIC ACID is employed in the development of inhibitors that protect metals from corrosion. Its chemical composition contributes to the formation of protective layers on metal surfaces, thereby extending their lifespan and reducing maintenance costs.
Overall, the versatility of 2,5-DIBROMOADIPIC ACID stems from its unique molecular structure and bromine content, making it a valuable compound in multiple industries for a variety of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3479-85-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,7 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3479-85:
(6*3)+(5*4)+(4*7)+(3*9)+(2*8)+(1*5)=114
114 % 10 = 4
So 3479-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8Br2O4/c7-3(5(9)10)1-2-4(8)6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)
3479-85-4Relevant academic research and scientific papers
Studies toward Cyclic Trisulfides. Trisulfide Polymers and Sulfur Extrusion1
Harpp, David N.,Smith, Roger A.,Steliou, Kosta
, p. 2072 - 2079 (2007/10/02)
Attempts were directed toward the synthesis of a variety of cyclic trisulfides, particularly by the reaction of N,N'-dibenzimidazolyl sulfide with dithiols.Only one monomeric cyclic trisulfide was prepared by this method; other cases yielded either mixtures of oligomers characterized as low molecular weight (5000) polymers or as products which spontaneously extruded sulfur to give the cyclic disulfides.We conlude that only where osmometric molecular weights or X-ray structures have been determined are monomeric cyclic trisulfides unambiguously defined.
