34895-26-6

Usage

Uses

Used in Organic Synthesis:
Maleic acid, lithium salt is used as a reagent in organic synthesis for its ability to participate in various chemical reactions, facilitating the formation of desired products.
Used in Polymerization Reactions:
In the polymer industry, maleic acid, lithium salt is used as a catalyst to initiate and control polymerization processes, leading to the production of polymers with specific properties.
Used as a Catalyst in Chemical Processes:
Maleic acid, lithium salt is employed as a catalyst in various chemical processes to enhance reaction rates and improve overall process efficiency.
Used in Pharmaceutical Production:
maleic acid, lithium salt is utilized in the production of pharmaceuticals, where it may act as an intermediate or aid in the synthesis of active pharmaceutical ingredients.
Used in Agricultural Chemical Production:
Maleic acid, lithium salt is used in the manufacturing of agricultural chemicals, potentially contributing to the development of pesticides, herbicides, or other agrochemicals.
Used in Specialty Chemical Production:
It is also employed in the production of specialty chemicals, which are tailored for specific industries and applications, such as coatings, adhesives, or advanced materials.
Used in Industrial Applications:
Due to its strong acidic nature and relatively non-toxic properties, maleic acid, lithium salt is used in various industrial applications where its chemical properties can be leveraged for process optimization or product enhancement.

InChI:InChI=1/C4H4O4.Li/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1/b2-1-;