34934-07-1 Usage
General Description
2-Amino-6-ethylbenzamide is a chemical compound with the molecular formula C10H13N2O. It is a derivative of benzamide, containing an amino group and an ethyl group attached to the benzene ring. 2-Amino-6-ethylbenzamide has various applications in organic synthesis and pharmaceutical research. It can act as a building block for the synthesis of more complex organic compounds, and it also possesses potential pharmacological properties due to its structure. Furthermore, 2-Amino-6-ethylbenzamide may be used as a precursor in the development of pharmaceutical drugs and agrochemicals. Its versatile nature and potential applications make it a valuable chemical compound in various fields of research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 34934-07-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,3 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 34934-07:
(7*3)+(6*4)+(5*9)+(4*3)+(3*4)+(2*0)+(1*7)=121
121 % 10 = 1
So 34934-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O/c1-2-6-4-3-5-7(10)8(6)9(11)12/h3-5H,2,10H2,1H3,(H2,11,12)
