34939-17-8 Usage
General Description
4,5-Dimethyl-2-pyrimidinol is a chemical compound with the molecular formula C6H8N2O. It is a white solid that is widely used in the production of pesticides and herbicides, as well as in the synthesis of pharmaceuticals. The compound is classified as a pyrimidine and contains two methyl groups attached to the 4 and 5 positions of the pyrimidine ring. 4,5-Dimethyl-2-pyrimidinol is known for its insecticidal and herbicidal properties, making it a valuable ingredient in the formulation of agricultural products. Additionally, it also has potential applications in the development of new drugs and pharmaceuticals due to its unique chemical structure and biological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 34939-17-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,3 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 34939-17:
(7*3)+(6*4)+(5*9)+(4*3)+(3*9)+(2*1)+(1*7)=138
138 % 10 = 8
So 34939-17-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-4-3-7-6(9)8-5(4)2/h3H,1-2H3,(H,7,8,9)